C23H29FNO5S2- — CID 175137368
1-[3-[[benzenesulfonyl(sulfinato)amino]methyl]-4-fluoro-4-methyl-2-propylpentanoyl]-4-methylbenzene (PubChem CID 175137368) has the molecular formula C23H29FNO5S2- and a molecular weight of 482.62 g/mol. Its IUPAC name is 1-[3-[[benzenesulfonyl(sulfinato)amino]methyl]-4-fluoro-4-methyl-2-propylpentanoyl]-4-methylbenzene.
| Compound Name | 1-[3-[[benzenesulfonyl(sulfinato)amino]methyl]-4-fluoro-4-methyl-2-propylpentanoyl]-4-methylbenzene |
|---|---|
| PubChem CID | 175137368 |
| Molecular Formula | C23H29FNO5S2- |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-[3-[[benzenesulfonyl(sulfinato)amino]methyl]-4-fluoro-4-methyl-2-propylpentanoyl]-4-methylbenzene |
| SMILES | CCCC(C(=O)c1ccc(C)cc1)C(CN(S(=O)[O-])S(=O)(=O)c1ccccc1)C(C)(C)F |
| InChI | InChI=1S/C23H30FNO5S2/c1-5-9-20(22(26)18-14-12-17(2)13-15-18)21(23(3,4)24)16-25(31(27)28)32(29,30)19-10-7-6-8-11-19/h6-8,10-15,20-21H,5,9,16H2,1-4H3,(H,27,28)/p-1 |
| InChIKey | IFAMBNMNAYASSV-UHFFFAOYSA-M |
| XLogP | 4.44 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|