C2H5FO3P+ — CID 175395071
2-fluoro-2-hydroxy-1,3,2-dioxaphospholan-2-ium (PubChem CID 175395071) has the molecular formula C2H5FO3P+ and a molecular weight of 127.03 g/mol. Its IUPAC name is 2-fluoro-2-hydroxy-1,3,2-dioxaphospholan-2-ium.
| Compound Name | 2-fluoro-2-hydroxy-1,3,2-dioxaphospholan-2-ium |
|---|---|
| PubChem CID | 175395071 |
| Molecular Formula | C2H5FO3P+ |
| Molecular Weight | 127.03 g/mol |
| Exact Mass | 127.00 |
| IUPAC Name | 2-fluoro-2-hydroxy-1,3,2-dioxaphospholan-2-ium |
| SMILES | O[P+]1(F)OCCO1 |
| InChI | InChI=1S/C2H5FO3P/c3-7(4)5-1-2-6-7/h4H,1-2H2/q+1 |
| InChIKey | FOADXECMESOZHK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.03 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|