C28H25ClN4O6 — CID 175395753
4-[[2-[[2-[5-chloro-2-(3-oxopyrrolidin-1-yl)anilino]-2-oxoacetyl]amino]-3-phenylpropanoyl]amino]benzoic acid (PubChem CID 175395753) has the molecular formula C28H25ClN4O6 and a molecular weight of 548.98 g/mol. Its IUPAC name is 4-[[2-[[2-[5-chloro-2-(3-oxopyrrolidin-1-yl)anilino]-2-oxoacetyl]amino]-3-phenylpropanoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[2-[5-chloro-2-(3-oxopyrrolidin-1-yl)anilino]-2-oxoacetyl]amino]-3-phenylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175395753 |
| Molecular Formula | C28H25ClN4O6 |
| Molecular Weight | 548.98 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 4-[[2-[[2-[5-chloro-2-(3-oxopyrrolidin-1-yl)anilino]-2-oxoacetyl]amino]-3-phenylpropanoyl]amino]benzoic acid |
| SMILES | O=C1CCN(c2ccc(Cl)cc2NC(=O)C(=O)NC(Cc2ccccc2)C(=O)Nc2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C28H25ClN4O6/c29-19-8-11-24(33-13-12-21(34)16-33)22(15-19)31-26(36)27(37)32-23(14-17-4-2-1-3-5-17)25(35)30-20-9-6-18(7-10-20)28(38)39/h1-11,15,23H,12-14,16H2,(H,30,35)(H,31,36)(H,32,37)(H,38,39) |
| InChIKey | PKWYIJMTZLRKKK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.98 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|