C25H19ClN8O7 — CID 175395691
4-[[(2S)-2-[[2-[5-chloro-2-(tetrazol-1-yl)anilino]-2-oxoacetyl]amino]-3-(4-nitrophenyl)propanoyl]amino]benzoic acid (PubChem CID 175395691) has the molecular formula C25H19ClN8O7 and a molecular weight of 578.93 g/mol. Its IUPAC name is 4-[[(2S)-2-[[2-[5-chloro-2-(tetrazol-1-yl)anilino]-2-oxoacetyl]amino]-3-(4-nitrophenyl)propanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-2-[[2-[5-chloro-2-(tetrazol-1-yl)anilino]-2-oxoacetyl]amino]-3-(4-nitrophenyl)propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175395691 |
| Molecular Formula | C25H19ClN8O7 |
| Molecular Weight | 578.93 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | 4-[[(2S)-2-[[2-[5-chloro-2-(tetrazol-1-yl)anilino]-2-oxoacetyl]amino]-3-(4-nitrophenyl)propanoyl]amino]benzoic acid |
| SMILES | O=C(Nc1cc(Cl)ccc1-n1cnnn1)C(=O)N[C@@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H19ClN8O7/c26-16-5-10-21(33-13-27-31-32-33)19(12-16)29-23(36)24(37)30-20(11-14-1-8-18(9-2-14)34(40)41)22(35)28-17-6-3-15(4-7-17)25(38)39/h1-10,12-13,20H,11H2,(H,28,35)(H,29,36)(H,30,37)(H,38,39)/t20-/m0/s1 |
| InChIKey | VBUUKLXLMWXUBK-FQEVSTJZSA-N |
| XLogP | 2.23 |
| TPSA | 211.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.93 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|