C30H24ClN9O7 — CID 175282483
5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]-1-methylindole-2-carboxylic acid (PubChem CID 175282483) has the molecular formula C30H24ClN9O7 and a molecular weight of 658.03 g/mol. Its IUPAC name is 5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]-1-methylindole-2-carboxylic acid.
| Compound Name | 5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]-1-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 175282483 |
| Molecular Formula | C30H24ClN9O7 |
| Molecular Weight | 658.03 g/mol |
| Exact Mass | 657.15 |
| IUPAC Name | 5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]-1-methylindole-2-carboxylic acid |
| SMILES | Cn1c(C(=O)O)cc2cc(NC(=O)C(Cc3ccc([N+](=O)[O-])cc3)N3CCN(c4cc(Cl)ccc4-n4cnnn4)C(=O)C3=O)ccc21 |
| InChI | InChI=1S/C30H24ClN9O7/c1-36-22-9-5-20(13-18(22)14-26(36)30(44)45)33-27(41)25(12-17-2-6-21(7-3-17)40(46)47)38-11-10-37(28(42)29(38)43)24-15-19(31)4-8-23(24)39-16-32-34-35-39/h2-9,13-16,25H,10-12H2,1H3,(H,33,41)(H,44,45) |
| InChIKey | VMKRTLPBWCORCL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 198.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.03 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|