C30H22ClN9O9 — CID 175281924
5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]indole-1,2-dicarboxylic acid (PubChem CID 175281924) has the molecular formula C30H22ClN9O9 and a molecular weight of 688.01 g/mol. Its IUPAC name is 5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]indole-1,2-dicarboxylic acid.
| Compound Name | 5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]indole-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 175281924 |
| Molecular Formula | C30H22ClN9O9 |
| Molecular Weight | 688.01 g/mol |
| Exact Mass | 687.12 |
| IUPAC Name | 5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]indole-1,2-dicarboxylic acid |
| SMILES | O=C(O)c1cc2cc(NC(=O)C(Cc3ccc([N+](=O)[O-])cc3)N3CCN(c4cc(Cl)ccc4-n4cnnn4)C(=O)C3=O)ccc2n1C(=O)O |
| InChI | InChI=1S/C30H22ClN9O9/c31-18-3-7-22(38-15-32-34-35-38)23(14-18)36-9-10-37(28(43)27(36)42)24(11-16-1-5-20(6-2-16)40(48)49)26(41)33-19-4-8-21-17(12-19)13-25(29(44)45)39(21)30(46)47/h1-8,12-15,24H,9-11H2,(H,33,41)(H,44,45)(H,46,47) |
| InChIKey | OIEVATKCOQNNBB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 235.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.01 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|