C29H21ClN8O8 — CID 175377043
5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]-1-benzofuran-2-carboxylic acid (PubChem CID 175377043) has the molecular formula C29H21ClN8O8 and a molecular weight of 644.99 g/mol. Its IUPAC name is 5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 175377043 |
| Molecular Formula | C29H21ClN8O8 |
| Molecular Weight | 644.99 g/mol |
| Exact Mass | 644.12 |
| IUPAC Name | 5-[[2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanoyl]amino]-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(NC(=O)C(Cc3ccc([N+](=O)[O-])cc3)N3CCN(c4cc(Cl)ccc4-n4cnnn4)C(=O)C3=O)ccc2o1 |
| InChI | InChI=1S/C29H21ClN8O8/c30-18-3-7-21(37-15-31-33-34-37)22(14-18)35-9-10-36(28(41)27(35)40)23(11-16-1-5-20(6-2-16)38(44)45)26(39)32-19-4-8-24-17(12-19)13-25(46-24)29(42)43/h1-8,12-15,23H,9-11H2,(H,32,39)(H,42,43) |
| InChIKey | ZURMAVMWJDMRRD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 206.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.99 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|