C31H31ClN8O6 — CID 165044140
phenyl N-[4-[(2S)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-[(2-methylpropan-2-yl)oxyamino]-3-oxopropyl]phenyl]carbamate (PubChem CID 165044140) has the molecular formula C31H31ClN8O6 and a molecular weight of 647.09 g/mol. Its IUPAC name is phenyl N-[4-[(2S)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-[(2-methylpropan-2-yl)oxyamino]-3-oxopropyl]phenyl]carbamate.
| Compound Name | phenyl N-[4-[(2S)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-[(2-methylpropan-2-yl)oxyamino]-3-oxopropyl]phenyl]carbamate |
|---|---|
| PubChem CID | 165044140 |
| Molecular Formula | C31H31ClN8O6 |
| Molecular Weight | 647.09 g/mol |
| Exact Mass | 646.21 |
| IUPAC Name | phenyl N-[4-[(2S)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]-3-[(2-methylpropan-2-yl)oxyamino]-3-oxopropyl]phenyl]carbamate |
| SMILES | CC(C)(C)ONC(=O)[C@H](Cc1ccc(NC(=O)Oc2ccccc2)cc1)N1CCN(c2cc(Cl)ccc2-n2cnnn2)C(=O)C1=O |
| InChI | InChI=1S/C31H31ClN8O6/c1-31(2,3)46-35-27(41)26(17-20-9-12-22(13-10-20)34-30(44)45-23-7-5-4-6-8-23)39-16-15-38(28(42)29(39)43)25-18-21(32)11-14-24(25)40-19-33-36-37-40/h4-14,18-19,26H,15-17H2,1-3H3,(H,34,44)(H,35,41)/t26-/m0/s1 |
| InChIKey | OPQJUUKVOZXGMD-SANMLTNESA-N |
| XLogP | 3.56 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.09 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|