C13H12ClN3O2S — CID 175396592
[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-cyclopropylamino]carbamic acid (PubChem CID 175396592) has the molecular formula C13H12ClN3O2S and a molecular weight of 309.78 g/mol. Its IUPAC name is [[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-cyclopropylamino]carbamic acid.
| Compound Name | [[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-cyclopropylamino]carbamic acid |
|---|---|
| PubChem CID | 175396592 |
| Molecular Formula | C13H12ClN3O2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | [[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-cyclopropylamino]carbamic acid |
| SMILES | O=C(O)NN(c1nc(-c2ccccc2Cl)cs1)C1CC1 |
| InChI | InChI=1S/C13H12ClN3O2S/c14-10-4-2-1-3-9(10)11-7-20-12(15-11)17(8-5-6-8)16-13(18)19/h1-4,7-8,16H,5-6H2,(H,18,19) |
| InChIKey | MCLVQHPJNOLGQC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|