C10H10ClN3S — CID 148913640
1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-methylhydrazine (PubChem CID 148913640) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-methylhydrazine.
| Compound Name | 1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-methylhydrazine |
|---|---|
| PubChem CID | 148913640 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-methylhydrazine |
| SMILES | CN(N)c1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C10H10ClN3S/c1-14(12)10-13-9(6-15-10)7-4-2-3-5-8(7)11/h2-6H,12H2,1H3 |
| InChIKey | PJCUTYZFJYINKI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|