C12H16N2O — CID 175396655
4-(pyridin-4-ylmethyl)piperidine-1-carbaldehyde (PubChem CID 175396655) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(pyridin-4-ylmethyl)piperidine-1-carbaldehyde.
| Compound Name | 4-(pyridin-4-ylmethyl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 175396655 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 4-(pyridin-4-ylmethyl)piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C12H16N2O/c15-10-14-7-3-12(4-8-14)9-11-1-5-13-6-2-11/h1-2,5-6,10,12H,3-4,7-9H2 |
| InChIKey | ZDMGYMORDPIBRV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|