C15H14ClN3O3 — CID 175396656
4-[5-(3-chlorophenyl)-1,3,4-oxadiazole-2-carbonyl]piperidine-1-carbaldehyde (PubChem CID 175396656) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is 4-[5-(3-chlorophenyl)-1,3,4-oxadiazole-2-carbonyl]piperidine-1-carbaldehyde.
| Compound Name | 4-[5-(3-chlorophenyl)-1,3,4-oxadiazole-2-carbonyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 175396656 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4-[5-(3-chlorophenyl)-1,3,4-oxadiazole-2-carbonyl]piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(C(=O)c2nnc(-c3cccc(Cl)c3)o2)CC1 |
| InChI | InChI=1S/C15H14ClN3O3/c16-12-3-1-2-11(8-12)14-17-18-15(22-14)13(21)10-4-6-19(9-20)7-5-10/h1-3,8-10H,4-7H2 |
| InChIKey | JRKVELNDQMLSCE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|