C17H15NO2 — CID 175400536
2-(6-methyl-2H-1,2-benzoxazin-4-yl)-1-phenylethanone (PubChem CID 175400536) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-(6-methyl-2H-1,2-benzoxazin-4-yl)-1-phenylethanone.
| Compound Name | 2-(6-methyl-2H-1,2-benzoxazin-4-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 175400536 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(6-methyl-2H-1,2-benzoxazin-4-yl)-1-phenylethanone |
| SMILES | Cc1ccc2c(c1)C(CC(=O)c1ccccc1)=CNO2 |
| InChI | InChI=1S/C17H15NO2/c1-12-7-8-17-15(9-12)14(11-18-20-17)10-16(19)13-5-3-2-4-6-13/h2-9,11,18H,10H2,1H3 |
| InChIKey | AXFYDPZSYQCFRK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |