C16H28N4O3 — CID 175400762
3-hexan-3-yl-1H-imidazol-3-ium;1,2,3-trimethylimidazol-1-ium;carbonate (PubChem CID 175400762) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is 3-hexan-3-yl-1H-imidazol-3-ium;1,2,3-trimethylimidazol-1-ium;carbonate.
| Compound Name | 3-hexan-3-yl-1H-imidazol-3-ium;1,2,3-trimethylimidazol-1-ium;carbonate |
|---|---|
| PubChem CID | 175400762 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 3-hexan-3-yl-1H-imidazol-3-ium;1,2,3-trimethylimidazol-1-ium;carbonate |
| SMILES | CCCC(CC)[n+]1cc[nH]c1.Cc1n(C)cc[n+]1C.O=C([O-])[O-] |
| InChI | InChI=1S/C9H16N2.C6H11N2.CH2O3/c1-3-5-9(4-2)11-7-6-10-8-11;1-6-7(2)4-5-8(6)3;2-1(3)4/h6-9H,3-5H2,1-2H3;4-5H,1-3H3;(H2,2,3,4)/q;+1;/p-1 |
| InChIKey | RSDQLDJHLLONKR-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|