About piperazine;trimethoxy(methyl)silane
piperazine;trimethoxy(methyl)silane (PubChem CID 175401324) has the molecular formula C8H22N2O3Si
and a molecular weight of 222.36 g/mol. Its IUPAC name is piperazine;trimethoxy(methyl)silane.
Molecular Properties
| Compound Name | piperazine;trimethoxy(methyl)silane |
| PubChem CID | 175401324 |
| Molecular Formula | C8H22N2O3Si |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | piperazine;trimethoxy(methyl)silane |
| SMILES | C1CNCCN1.CO[Si](C)(OC)OC |
| InChI | InChI=1S/C4H10N2.C4H12O3Si/c1-2-6-4-3-5-1;1-5-8(4,6-2)7-3/h5-6H,1-4H2;1-4H3 |
| InChIKey | LENOGYXEUIYFLY-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze piperazine;trimethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;trimethoxy(methyl)silane?
The IUPAC name of piperazine;trimethoxy(methyl)silane (CID 175401324) is piperazine;trimethoxy(methyl)silane.
What is the SMILES notation for piperazine;trimethoxy(methyl)silane?
The canonical SMILES for piperazine;trimethoxy(methyl)silane is C1CNCCN1.CO[Si](C)(OC)OC.
What is the InChIKey of piperazine;trimethoxy(methyl)silane?
The InChIKey is LENOGYXEUIYFLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.C4H12O3Si/c1-2-6-4-3-5-1;1-5-8(4,6-2)7-3/h5-6H,1-4H2;1-4H3.
What are the key properties of piperazine;trimethoxy(methyl)silane?
piperazine;trimethoxy(methyl)silane has a molecular weight of 222.36 g/mol, XLogP of -0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;trimethoxy(methyl)silane is sourced from PubChem (CID 175401324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).