C9H15ClN2 — CID 175402454
1-(3,4-dimethyl-2-pyridinyl)ethanamine;hydrochloride (PubChem CID 175402454) has the molecular formula C9H15ClN2 and a molecular weight of 186.69 g/mol. Its IUPAC name is 1-(3,4-dimethyl-2-pyridinyl)ethanamine;hydrochloride.
| Compound Name | 1-(3,4-dimethyl-2-pyridinyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 175402454 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1-(3,4-dimethyl-2-pyridinyl)ethanamine;hydrochloride |
| SMILES | Cc1ccnc(C(C)N)c1C.Cl |
| InChI | InChI=1S/C9H14N2.ClH/c1-6-4-5-11-9(7(6)2)8(3)10;/h4-5,8H,10H2,1-3H3;1H |
| InChIKey | OEDOHAKTZQQENX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |