C13H25NS — CID 156733266
3,4-dimethyl-2-propan-2-ylpyridine;propane;sulfane (PubChem CID 156733266) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is 3,4-dimethyl-2-propan-2-ylpyridine;propane;sulfane.
| Compound Name | 3,4-dimethyl-2-propan-2-ylpyridine;propane;sulfane |
|---|---|
| PubChem CID | 156733266 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 3,4-dimethyl-2-propan-2-ylpyridine;propane;sulfane |
| SMILES | CCC.Cc1ccnc(C(C)C)c1C.S |
| InChI | InChI=1S/C10H15N.C3H8.H2S/c1-7(2)10-9(4)8(3)5-6-11-10;1-3-2;/h5-7H,1-4H3;3H2,1-2H3;1H2 |
| InChIKey | JNHUBZLRJKORMQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |