C16H27N — CID 154662162
3-(2-methylbutan-2-yl)-2,4-di(propan-2-yl)pyridine (PubChem CID 154662162) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 3-(2-methylbutan-2-yl)-2,4-di(propan-2-yl)pyridine.
| Compound Name | 3-(2-methylbutan-2-yl)-2,4-di(propan-2-yl)pyridine |
|---|---|
| PubChem CID | 154662162 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 3-(2-methylbutan-2-yl)-2,4-di(propan-2-yl)pyridine |
| SMILES | CCC(C)(C)c1c(C(C)C)ccnc1C(C)C |
| InChI | InChI=1S/C16H27N/c1-8-16(6,7)14-13(11(2)3)9-10-17-15(14)12(4)5/h9-12H,8H2,1-7H3 |
| InChIKey | OQOFPOOQVGTYLI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |