C22H18Cl2F3N2O4S- — CID 175402851
2,6-dichloro-4-[[2-[4-[methyl(sulfinato)amino]phenyl]acetyl]amino]-1-phenyl-6-(trifluoromethoxy)cyclohexa-1,3-diene (PubChem CID 175402851) has the molecular formula C22H18Cl2F3N2O4S- and a molecular weight of 534.36 g/mol. Its IUPAC name is 2,6-dichloro-4-[[2-[4-[methyl(sulfinato)amino]phenyl]acetyl]amino]-1-phenyl-6-(trifluoromethoxy)cyclohexa-1,3-diene.
| Compound Name | 2,6-dichloro-4-[[2-[4-[methyl(sulfinato)amino]phenyl]acetyl]amino]-1-phenyl-6-(trifluoromethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175402851 |
| Molecular Formula | C22H18Cl2F3N2O4S- |
| Molecular Weight | 534.36 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | 2,6-dichloro-4-[[2-[4-[methyl(sulfinato)amino]phenyl]acetyl]amino]-1-phenyl-6-(trifluoromethoxy)cyclohexa-1,3-diene |
| SMILES | CN(c1ccc(CC(=O)NC2=CC(Cl)=C(c3ccccc3)C(Cl)(OC(F)(F)F)C2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C22H19Cl2F3N2O4S/c1-29(34(31)32)17-9-7-14(8-10-17)11-19(30)28-16-12-18(23)20(15-5-3-2-4-6-15)21(24,13-16)33-22(25,26)27/h2-10,12H,11,13H2,1H3,(H,28,30)(H,31,32)/p-1 |
| InChIKey | NGRNQPIJDJMNQG-UHFFFAOYSA-M |
| XLogP | 4.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|