C17H18O6 — CID 175405129
(2,3-dimethoxyphenyl) 2-phenoxyethyl carbonate (PubChem CID 175405129) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl) 2-phenoxyethyl carbonate.
| Compound Name | (2,3-dimethoxyphenyl) 2-phenoxyethyl carbonate |
|---|---|
| PubChem CID | 175405129 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (2,3-dimethoxyphenyl) 2-phenoxyethyl carbonate |
| SMILES | COc1cccc(OC(=O)OCCOc2ccccc2)c1OC |
| InChI | InChI=1S/C17H18O6/c1-19-14-9-6-10-15(16(14)20-2)23-17(18)22-12-11-21-13-7-4-3-5-8-13/h3-10H,11-12H2,1-2H3 |
| InChIKey | DZANBDTUWADWBQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|