About oxathiaziridine;bis(N-phenylbutane-1-sulfonamide)
oxathiaziridine;bis(N-phenylbutane-1-sulfonamide) (PubChem CID 175405925) has the molecular formula C20H31N3O5S3
and a molecular weight of 489.69 g/mol. Its IUPAC name is oxathiaziridine;bis(N-phenylbutane-1-sulfonamide).
Molecular Properties
| Compound Name | oxathiaziridine;bis(N-phenylbutane-1-sulfonamide) |
| PubChem CID | 175405925 |
| Molecular Formula | C20H31N3O5S3 |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | oxathiaziridine;bis(N-phenylbutane-1-sulfonamide) |
| SMILES | CCCCS(=O)(=O)Nc1ccccc1.CCCCS(=O)(=O)Nc1ccccc1.[nH]1os1 |
| InChI | InChI=1S/2C10H15NO2S.HNOS/c2*1-2-3-9-14(12,13)11-10-7-5-4-6-8-10;1-2-3-1/h2*4-8,11H,2-3,9H2,1H3;1H |
| InChIKey | AGKXORJIKCENIP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxathiaziridine;bis(N-phenylbutane-1-sulfonamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxathiaziridine;bis(N-phenylbutane-1-sulfonamide)?
The IUPAC name of oxathiaziridine;bis(N-phenylbutane-1-sulfonamide) (CID 175405925) is oxathiaziridine;bis(N-phenylbutane-1-sulfonamide).
What is the SMILES notation for oxathiaziridine;bis(N-phenylbutane-1-sulfonamide)?
The canonical SMILES for oxathiaziridine;bis(N-phenylbutane-1-sulfonamide) is CCCCS(=O)(=O)Nc1ccccc1.CCCCS(=O)(=O)Nc1ccccc1.[nH]1os1.
What is the InChIKey of oxathiaziridine;bis(N-phenylbutane-1-sulfonamide)?
The InChIKey is AGKXORJIKCENIP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H15NO2S.HNOS/c2*1-2-3-9-14(12,13)11-10-7-5-4-6-8-10;1-2-3-1/h2*4-8,11H,2-3,9H2,1H3;1H.
What are the key properties of oxathiaziridine;bis(N-phenylbutane-1-sulfonamide)?
oxathiaziridine;bis(N-phenylbutane-1-sulfonamide) has a molecular weight of 489.69 g/mol, XLogP of 5.13, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxathiaziridine;bis(N-phenylbutane-1-sulfonamide) is sourced from PubChem (CID 175405925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).