C11H19N3O4S2 — CID 110606791
N-phenyl-2-(propylsulfamoylamino)ethanesulfonamide (PubChem CID 110606791) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-phenyl-2-(propylsulfamoylamino)ethanesulfonamide.
| Compound Name | N-phenyl-2-(propylsulfamoylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 110606791 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-phenyl-2-(propylsulfamoylamino)ethanesulfonamide |
| SMILES | CCCNS(=O)(=O)NCCS(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H19N3O4S2/c1-2-8-12-20(17,18)13-9-10-19(15,16)14-11-6-4-3-5-7-11/h3-7,12-14H,2,8-10H2,1H3 |
| InChIKey | YYQIGLJOWASHCM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |