About butoxyphosphonamidic acid;guanidine
butoxyphosphonamidic acid;guanidine (PubChem CID 175407488) has the molecular formula C5H17N4O3P
and a molecular weight of 212.19 g/mol. Its IUPAC name is butoxyphosphonamidic acid;guanidine.
Molecular Properties
| Compound Name | butoxyphosphonamidic acid;guanidine |
| PubChem CID | 175407488 |
| Molecular Formula | C5H17N4O3P |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | butoxyphosphonamidic acid;guanidine |
| SMILES | CCCCOP(N)(=O)O.[H]N=C(N)N |
| InChI | InChI=1S/C4H12NO3P.CH5N3/c1-2-3-4-8-9(5,6)7;2-1(3)4/h2-4H2,1H3,(H3,5,6,7);(H5,2,3,4) |
| InChIKey | YGCVFAPZDOIGJD-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butoxyphosphonamidic acid;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxyphosphonamidic acid;guanidine?
The IUPAC name of butoxyphosphonamidic acid;guanidine (CID 175407488) is butoxyphosphonamidic acid;guanidine.
What is the SMILES notation for butoxyphosphonamidic acid;guanidine?
The canonical SMILES for butoxyphosphonamidic acid;guanidine is CCCCOP(N)(=O)O.[H]N=C(N)N.
What is the InChIKey of butoxyphosphonamidic acid;guanidine?
The InChIKey is YGCVFAPZDOIGJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12NO3P.CH5N3/c1-2-3-4-8-9(5,6)7;2-1(3)4/h2-4H2,1H3,(H3,5,6,7);(H5,2,3,4).
What are the key properties of butoxyphosphonamidic acid;guanidine?
butoxyphosphonamidic acid;guanidine has a molecular weight of 212.19 g/mol, XLogP of -0.30, 4 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butoxyphosphonamidic acid;guanidine is sourced from PubChem (CID 175407488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).