C32H33FN4O5 — CID 175407613
[4-[(dimethylamino)methyl]benzoyl] 3-[(4-cyclopentylphenyl)carbamoylamino]-5-fluoro-2-methylindole-1-carboperoxoate (PubChem CID 175407613) has the molecular formula C32H33FN4O5 and a molecular weight of 572.64 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]benzoyl] 3-[(4-cyclopentylphenyl)carbamoylamino]-5-fluoro-2-methylindole-1-carboperoxoate.
| Compound Name | [4-[(dimethylamino)methyl]benzoyl] 3-[(4-cyclopentylphenyl)carbamoylamino]-5-fluoro-2-methylindole-1-carboperoxoate |
|---|---|
| PubChem CID | 175407613 |
| Molecular Formula | C32H33FN4O5 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | [4-[(dimethylamino)methyl]benzoyl] 3-[(4-cyclopentylphenyl)carbamoylamino]-5-fluoro-2-methylindole-1-carboperoxoate |
| SMILES | Cc1c(NC(=O)Nc2ccc(C3CCCC3)cc2)c2cc(F)ccc2n1C(=O)OOC(=O)c1ccc(CN(C)C)cc1 |
| InChI | InChI=1S/C32H33FN4O5/c1-20-29(35-31(39)34-26-15-12-23(13-16-26)22-6-4-5-7-22)27-18-25(33)14-17-28(27)37(20)32(40)42-41-30(38)24-10-8-21(9-11-24)19-36(2)3/h8-18,22H,4-7,19H2,1-3H3,(H2,34,35,39) |
| InChIKey | FWZIAFMNISOAHH-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|