C19H17ClF2N4O — CID 175407715
1-(5-chloro-1H-indol-3-yl)-3-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]urea (PubChem CID 175407715) has the molecular formula C19H17ClF2N4O and a molecular weight of 390.82 g/mol. Its IUPAC name is 1-(5-chloro-1H-indol-3-yl)-3-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]urea.
| Compound Name | 1-(5-chloro-1H-indol-3-yl)-3-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 175407715 |
| Molecular Formula | C19H17ClF2N4O |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 1-(5-chloro-1H-indol-3-yl)-3-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(N2CCC(F)(F)C2)cc1)Nc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H17ClF2N4O/c20-12-1-6-16-15(9-12)17(10-23-16)25-18(27)24-13-2-4-14(5-3-13)26-8-7-19(21,22)11-26/h1-6,9-10,23H,7-8,11H2,(H2,24,25,27) |
| InChIKey | DJRYWLSZWVVOJI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|