C22H24ClN3O — CID 113209558
2-(5-chloro-1H-indol-3-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide (PubChem CID 113209558) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is 2-(5-chloro-1H-indol-3-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(5-chloro-1H-indol-3-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 113209558 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-(5-chloro-1H-indol-3-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide |
| SMILES | CC1CCN(c2ccc(NC(=O)Cc3c[nH]c4ccc(Cl)cc34)cc2)CC1 |
| InChI | InChI=1S/C22H24ClN3O/c1-15-8-10-26(11-9-15)19-5-3-18(4-6-19)25-22(27)12-16-14-24-21-7-2-17(23)13-20(16)21/h2-7,13-15,24H,8-12H2,1H3,(H,25,27) |
| InChIKey | ZUVWTMUPQNZKSS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|