C25H23BrClNO2S — CID 175408515
3-(bromomethyl)-5-(4-chlorophenyl)sulfonyl-1-(2-methylphenyl)-4-phenyl-3,6-dihydro-2H-pyridine (PubChem CID 175408515) has the molecular formula C25H23BrClNO2S and a molecular weight of 516.89 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(4-chlorophenyl)sulfonyl-1-(2-methylphenyl)-4-phenyl-3,6-dihydro-2H-pyridine.
| Compound Name | 3-(bromomethyl)-5-(4-chlorophenyl)sulfonyl-1-(2-methylphenyl)-4-phenyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 175408515 |
| Molecular Formula | C25H23BrClNO2S |
| Molecular Weight | 516.89 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | 3-(bromomethyl)-5-(4-chlorophenyl)sulfonyl-1-(2-methylphenyl)-4-phenyl-3,6-dihydro-2H-pyridine |
| SMILES | Cc1ccccc1N1CC(S(=O)(=O)c2ccc(Cl)cc2)=C(c2ccccc2)C(CBr)C1 |
| InChI | InChI=1S/C25H23BrClNO2S/c1-18-7-5-6-10-23(18)28-16-20(15-26)25(19-8-3-2-4-9-19)24(17-28)31(29,30)22-13-11-21(27)12-14-22/h2-14,20H,15-17H2,1H3 |
| InChIKey | WHRZAOPZFYLUJH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.89 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|