C23H20O4SSe — CID 10027733
4-(benzenesulfonyl)-5-phenyl-2-(phenylseleninylmethyl)-2,3-dihydrofuran (PubChem CID 10027733) has the molecular formula C23H20O4SSe and a molecular weight of 471.44 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-phenyl-2-(phenylseleninylmethyl)-2,3-dihydrofuran.
| Compound Name | 4-(benzenesulfonyl)-5-phenyl-2-(phenylseleninylmethyl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 10027733 |
| Molecular Formula | C23H20O4SSe |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | 4-(benzenesulfonyl)-5-phenyl-2-(phenylseleninylmethyl)-2,3-dihydrofuran |
| SMILES | O=[Se](CC1CC(S(=O)(=O)c2ccccc2)=C(c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C23H20O4SSe/c24-28(25,20-12-6-2-7-13-20)22-16-19(17-29(26)21-14-8-3-9-15-21)27-23(22)18-10-4-1-5-11-18/h1-15,19H,16-17H2 |
| InChIKey | WABLGSJJQXJQLH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|