C54H45O6PPdS2 — CID 146164037
3-(4-methylphenyl)sulfonyl-5-[2-[4-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydrofuran-2-yl]ethenyl]-2-phenylfuran;palladium;triphenylphosphanium (PubChem CID 146164037) has the molecular formula C54H45O6PPdS2 and a molecular weight of 991.48 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-5-[2-[4-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydrofuran-2-yl]ethenyl]-2-phenylfuran;palladium;triphenylphosphanium.
| Compound Name | 3-(4-methylphenyl)sulfonyl-5-[2-[4-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydrofuran-2-yl]ethenyl]-2-phenylfuran;palladium;triphenylphosphanium |
|---|---|
| PubChem CID | 146164037 |
| Molecular Formula | C54H45O6PPdS2 |
| Molecular Weight | 991.48 g/mol |
| Exact Mass | 990.14 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-5-[2-[4-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydrofuran-2-yl]ethenyl]-2-phenylfuran;palladium;triphenylphosphanium |
| SMILES | Cc1ccc(S(=O)(=O)C2=C(c3ccccc3)OC(/[C-]=C\c3cc(S(=O)(=O)c4ccc(C)cc4)c(-c4ccccc4)o3)C2)cc1.[Pd].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H29O6S2.C18H15P.Pd/c1-25-13-19-31(20-14-25)43(37,38)33-23-29(41-35(33)27-9-5-3-6-10-27)17-18-30-24-34(36(42-30)28-11-7-4-8-12-28)44(39,40)32-21-15-26(2)16-22-32;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h3-17,19-23,30H,24H2,1-2H3;1-15H;/q-1;;/p+1 |
| InChIKey | AYPMIVRDWRCGRY-UHFFFAOYSA-O |
| XLogP | 11.02 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.48 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|