C28H22O5S — CID 10983557
4-(benzenesulfonyl)-2,2-diphenoxy-5-phenyl-3H-furan (PubChem CID 10983557) has the molecular formula C28H22O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2,2-diphenoxy-5-phenyl-3H-furan.
| Compound Name | 4-(benzenesulfonyl)-2,2-diphenoxy-5-phenyl-3H-furan |
|---|---|
| PubChem CID | 10983557 |
| Molecular Formula | C28H22O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 4-(benzenesulfonyl)-2,2-diphenoxy-5-phenyl-3H-furan |
| SMILES | O=S(=O)(C1=C(c2ccccc2)OC(Oc2ccccc2)(Oc2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C28H22O5S/c29-34(30,25-19-11-4-12-20-25)26-21-28(31-23-15-7-2-8-16-23,32-24-17-9-3-10-18-24)33-27(26)22-13-5-1-6-14-22/h1-20H,21H2 |
| InChIKey | ZMCPLXDEVMYCSW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|