C29H24N2O4S — CID 75968171
4-[4-(benzenesulfonyl)-2,2-diphenyl-3H-furan-5-yl]-N'-hydroxybenzenecarboximidamide (PubChem CID 75968171) has the molecular formula C29H24N2O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)-2,2-diphenyl-3H-furan-5-yl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[4-(benzenesulfonyl)-2,2-diphenyl-3H-furan-5-yl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 75968171 |
| Molecular Formula | C29H24N2O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 4-[4-(benzenesulfonyl)-2,2-diphenyl-3H-furan-5-yl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(C2=C(S(=O)(=O)c3ccccc3)CC(c3ccccc3)(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C29H24N2O4S/c30-28(31-32)22-18-16-21(17-19-22)27-26(36(33,34)25-14-8-3-9-15-25)20-29(35-27,23-10-4-1-5-11-23)24-12-6-2-7-13-24/h1-19,32H,20H2,(H2,30,31) |
| InChIKey | MOOXJWIZYGHVNY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|