C36H31N5O5S — CID 52949717
N'-hydroxy-4-[4-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonyl-2,2-diphenyl-3H-furan-5-yl]anilino]benzenecarboximidamide (PubChem CID 52949717) has the molecular formula C36H31N5O5S and a molecular weight of 645.74 g/mol. Its IUPAC name is N'-hydroxy-4-[4-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonyl-2,2-diphenyl-3H-furan-5-yl]anilino]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[4-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonyl-2,2-diphenyl-3H-furan-5-yl]anilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 52949717 |
| Molecular Formula | C36H31N5O5S |
| Molecular Weight | 645.74 g/mol |
| Exact Mass | 645.20 |
| IUPAC Name | N'-hydroxy-4-[4-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonyl-2,2-diphenyl-3H-furan-5-yl]anilino]benzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(Nc2ccc(C3=C(S(=O)(=O)c4ccc(/C(N)=N/O)cc4)CC(c4ccccc4)(c4ccccc4)O3)cc2)cc1 |
| InChI | InChI=1S/C36H31N5O5S/c37-34(40-42)25-13-19-30(20-14-25)39-29-17-11-24(12-18-29)33-32(47(44,45)31-21-15-26(16-22-31)35(38)41-43)23-36(46-33,27-7-3-1-4-8-27)28-9-5-2-6-10-28/h1-22,39,42-43H,23H2,(H2,37,40)(H2,38,41) |
| InChIKey | KBTOEOJFNVQJFN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 172.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.74 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|