C26H25FN2O5S — CID 118717278
4-[2-ethyl-4-(4-fluorophenyl)sulfonyl-2-(2-methoxyphenyl)-3H-furan-5-yl]-N'-hydroxybenzenecarboximidamide (PubChem CID 118717278) has the molecular formula C26H25FN2O5S and a molecular weight of 496.56 g/mol. Its IUPAC name is 4-[2-ethyl-4-(4-fluorophenyl)sulfonyl-2-(2-methoxyphenyl)-3H-furan-5-yl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[2-ethyl-4-(4-fluorophenyl)sulfonyl-2-(2-methoxyphenyl)-3H-furan-5-yl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 118717278 |
| Molecular Formula | C26H25FN2O5S |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 4-[2-ethyl-4-(4-fluorophenyl)sulfonyl-2-(2-methoxyphenyl)-3H-furan-5-yl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCC1(c2ccccc2OC)CC(S(=O)(=O)c2ccc(F)cc2)=C(c2ccc(/C(N)=N\O)cc2)O1 |
| InChI | InChI=1S/C26H25FN2O5S/c1-3-26(21-6-4-5-7-22(21)33-2)16-23(35(31,32)20-14-12-19(27)13-15-20)24(34-26)17-8-10-18(11-9-17)25(28)29-30/h4-15,30H,3,16H2,1-2H3,(H2,28,29) |
| InChIKey | CYLWAVDADYOQMF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|