C25H29FO3S — CID 132543922
(4aS,8aS)-2-(4-fluorophenyl)-5,5,8a-trimethyl-3-(4-methylphenyl)sulfonyl-4a,6,7,8-tetrahydro-4H-chromene (PubChem CID 132543922) has the molecular formula C25H29FO3S and a molecular weight of 428.57 g/mol. Its IUPAC name is (4aS,8aS)-2-(4-fluorophenyl)-5,5,8a-trimethyl-3-(4-methylphenyl)sulfonyl-4a,6,7,8-tetrahydro-4H-chromene.
| Compound Name | (4aS,8aS)-2-(4-fluorophenyl)-5,5,8a-trimethyl-3-(4-methylphenyl)sulfonyl-4a,6,7,8-tetrahydro-4H-chromene |
|---|---|
| PubChem CID | 132543922 |
| Molecular Formula | C25H29FO3S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (4aS,8aS)-2-(4-fluorophenyl)-5,5,8a-trimethyl-3-(4-methylphenyl)sulfonyl-4a,6,7,8-tetrahydro-4H-chromene |
| SMILES | Cc1ccc(S(=O)(=O)C2=C(c3ccc(F)cc3)O[C@@]3(C)CCCC(C)(C)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C25H29FO3S/c1-17-6-12-20(13-7-17)30(27,28)21-16-22-24(2,3)14-5-15-25(22,4)29-23(21)18-8-10-19(26)11-9-18/h6-13,22H,5,14-16H2,1-4H3/t22-,25-/m0/s1 |
| InChIKey | GEWFWKOLDXBBKY-DHLKQENFSA-N |
| XLogP | 6.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |