About 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt
2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt (PubChem CID 175409061) has the molecular formula C13H13CoN3O3
and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt.
Molecular Properties
| Compound Name | 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt |
| PubChem CID | 175409061 |
| Molecular Formula | C13H13CoN3O3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt |
| SMILES | Cc1ccc(Nc2cc([N+](=O)[O-])ccc2N)c(O)c1.[Co] |
| InChI | InChI=1S/C13H13N3O3.Co/c1-8-2-5-11(13(17)6-8)15-12-7-9(16(18)19)3-4-10(12)14;/h2-7,15,17H,14H2,1H3; |
| InChIKey | AAAXARAYDNPEJR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt?
The IUPAC name of 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt (CID 175409061) is 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt.
What is the SMILES notation for 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt?
The canonical SMILES for 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt is Cc1ccc(Nc2cc([N+](=O)[O-])ccc2N)c(O)c1.[Co].
What is the InChIKey of 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt?
The InChIKey is AAAXARAYDNPEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3.Co/c1-8-2-5-11(13(17)6-8)15-12-7-9(16(18)19)3-4-10(12)14;/h2-7,15,17H,14H2,1H3;.
What are the key properties of 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt?
2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt has a molecular weight of 318.20 g/mol, XLogP of 2.93, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-5-nitroanilino)-5-methylphenol;cobalt is sourced from PubChem (CID 175409061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).