C15H14ClN3O5 — CID 19771102
ethyl N-[2-(5-chloro-2-hydroxyanilino)-5-nitrophenyl]carbamate (PubChem CID 19771102) has the molecular formula C15H14ClN3O5 and a molecular weight of 351.75 g/mol. Its IUPAC name is ethyl N-[2-(5-chloro-2-hydroxyanilino)-5-nitrophenyl]carbamate.
| Compound Name | ethyl N-[2-(5-chloro-2-hydroxyanilino)-5-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 19771102 |
| Molecular Formula | C15H14ClN3O5 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | ethyl N-[2-(5-chloro-2-hydroxyanilino)-5-nitrophenyl]carbamate |
| SMILES | CCOC(=O)Nc1cc([N+](=O)[O-])ccc1Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H14ClN3O5/c1-2-24-15(21)18-12-8-10(19(22)23)4-5-11(12)17-13-7-9(16)3-6-14(13)20/h3-8,17,20H,2H2,1H3,(H,18,21) |
| InChIKey | CKZBJAURVFZWKP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|