About 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid
3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid (PubChem CID 175410771) has the molecular formula C30H29F2NO3
and a molecular weight of 489.56 g/mol. Its IUPAC name is 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid |
| PubChem CID | 175410771 |
| Molecular Formula | C30H29F2NO3 |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid |
| SMILES | CC(C)c1c(Cc2cccc(C(=O)O)c2)c2cc(OCc3ccccc3)ccc2n1C1CC(F)(F)C1 |
| InChI | InChI=1S/C30H29F2NO3/c1-19(2)28-26(14-21-9-6-10-22(13-21)29(34)35)25-15-24(36-18-20-7-4-3-5-8-20)11-12-27(25)33(28)23-16-30(31,32)17-23/h3-13,15,19,23H,14,16-18H2,1-2H3,(H,34,35) |
| InChIKey | HSYVPLPAPJRATF-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid?
The IUPAC name of 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid (CID 175410771) is 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid.
What is the SMILES notation for 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid?
The canonical SMILES for 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid is CC(C)c1c(Cc2cccc(C(=O)O)c2)c2cc(OCc3ccccc3)ccc2n1C1CC(F)(F)C1.
What is the InChIKey of 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid?
The InChIKey is HSYVPLPAPJRATF-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H29F2NO3/c1-19(2)28-26(14-21-9-6-10-22(13-21)29(34)35)25-15-24(36-18-20-7-4-3-5-8-20)11-12-27(25)33(28)23-16-30(31,32)17-23/h3-13,15,19,23H,14,16-18H2,1-2H3,(H,34,35).
What are the key properties of 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid?
3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid has a molecular weight of 489.56 g/mol, XLogP of 7.60, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(3,3-difluorocyclobutyl)-5-phenylmethoxy-2-propan-2-ylindol-3-yl]methyl]benzoic acid is sourced from PubChem (CID 175410771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).