C15H25NaO — CID 175411309
sodium;2-hexylcyclopenta-1,3-diene;oxolane (PubChem CID 175411309) has the molecular formula C15H25NaO and a molecular weight of 244.35 g/mol. Its IUPAC name is sodium;2-hexylcyclopenta-1,3-diene;oxolane.
| Compound Name | sodium;2-hexylcyclopenta-1,3-diene;oxolane |
|---|---|
| PubChem CID | 175411309 |
| Molecular Formula | C15H25NaO |
| Molecular Weight | 244.35 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | sodium;2-hexylcyclopenta-1,3-diene;oxolane |
| SMILES | C1CCOC1.CCCCCCC1=[C-]CC=C1.[Na+] |
| InChI | InChI=1S/C11H17.C4H8O.Na/c1-2-3-4-5-8-11-9-6-7-10-11;1-2-4-5-3-1;/h6,9H,2-5,7-8H2,1H3;1-4H2;/q-1;;+1 |
| InChIKey | RYSICTVVKZFJRM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|