C24H38Fe — CID 20531351
bis(2-heptylcyclopenta-1,3-diene);iron(2+) (PubChem CID 20531351) has the molecular formula C24H38Fe and a molecular weight of 382.41 g/mol. Its IUPAC name is bis(2-heptylcyclopenta-1,3-diene);iron(2+).
| Compound Name | bis(2-heptylcyclopenta-1,3-diene);iron(2+) |
|---|---|
| PubChem CID | 20531351 |
| Molecular Formula | C24H38Fe |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | bis(2-heptylcyclopenta-1,3-diene);iron(2+) |
| SMILES | CCCCCCCC1=[C-]CC=C1.CCCCCCCC1=[C-]CC=C1.[Fe+2] |
| InChI | InChI=1S/2C12H19.Fe/c2*1-2-3-4-5-6-9-12-10-7-8-11-12;/h2*7,10H,2-6,8-9H2,1H3;/q2*-1;+2 |
| InChIKey | UUKGLLDCDIBVLJ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|