C20H13BrF4N2O6 — CID 175417804
[2-[2-bromo-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]phenyl] ethaneperoxoate (PubChem CID 175417804) has the molecular formula C20H13BrF4N2O6 and a molecular weight of 533.23 g/mol. Its IUPAC name is [2-[2-bromo-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]phenyl] ethaneperoxoate.
| Compound Name | [2-[2-bromo-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]phenyl] ethaneperoxoate |
|---|---|
| PubChem CID | 175417804 |
| Molecular Formula | C20H13BrF4N2O6 |
| Molecular Weight | 533.23 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | [2-[2-bromo-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]phenyl] ethaneperoxoate |
| SMILES | CC(=O)OOc1ccccc1Oc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1Br |
| InChI | InChI=1S/C20H13BrF4N2O6/c1-10(28)32-33-15-6-4-3-5-14(15)31-16-8-13(12(22)7-11(16)21)27-18(29)9-17(20(23,24)25)26(2)19(27)30/h3-9H,1-2H3 |
| InChIKey | MOHCIIHFEPBQSR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|