C24H17BrF4N2O7 — CID 156846062
prop-2-ynyl (2R)-2-[2-[2-bromo-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]phenoxy]-2-methoxyacetate (PubChem CID 156846062) has the molecular formula C24H17BrF4N2O7 and a molecular weight of 601.30 g/mol. Its IUPAC name is prop-2-ynyl (2R)-2-[2-[2-bromo-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]phenoxy]-2-methoxyacetate.
| Compound Name | prop-2-ynyl (2R)-2-[2-[2-bromo-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]phenoxy]-2-methoxyacetate |
|---|---|
| PubChem CID | 156846062 |
| Molecular Formula | C24H17BrF4N2O7 |
| Molecular Weight | 601.30 g/mol |
| Exact Mass | 600.02 |
| IUPAC Name | prop-2-ynyl (2R)-2-[2-[2-bromo-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]phenoxy]-2-methoxyacetate |
| SMILES | C#CCOC(=O)[C@H](OC)Oc1ccccc1Oc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1Br |
| InChI | InChI=1S/C24H17BrF4N2O7/c1-4-9-36-21(33)22(35-3)38-17-8-6-5-7-16(17)37-18-11-15(14(26)10-13(18)25)31-20(32)12-19(24(27,28)29)30(2)23(31)34/h1,5-8,10-12,22H,9H2,2-3H3/t22-/m1/s1 |
| InChIKey | RDYRFHXNIIUEHJ-JOCHJYFZSA-N |
| XLogP | 3.78 |
| TPSA | 97.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|