About 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate
4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate (PubChem CID 175418228) has the molecular formula C11H22O5SSi
and a molecular weight of 294.44 g/mol. Its IUPAC name is 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate.
Molecular Properties
| Compound Name | 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate |
| PubChem CID | 175418228 |
| Molecular Formula | C11H22O5SSi |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate |
| SMILES | CO[Si](CCCCOC(=O)C1(C)CS1)(OC)OC |
| InChI | InChI=1S/C11H22O5SSi/c1-11(9-17-11)10(12)16-7-5-6-8-18(13-2,14-3)15-4/h5-9H2,1-4H3 |
| InChIKey | DIJJQCQMXUQWGX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate?
The IUPAC name of 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate (CID 175418228) is 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate.
What is the SMILES notation for 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate?
The canonical SMILES for 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate is CO[Si](CCCCOC(=O)C1(C)CS1)(OC)OC.
What is the InChIKey of 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate?
The InChIKey is DIJJQCQMXUQWGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O5SSi/c1-11(9-17-11)10(12)16-7-5-6-8-18(13-2,14-3)15-4/h5-9H2,1-4H3.
What are the key properties of 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate?
4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate has a molecular weight of 294.44 g/mol, XLogP of 1.69, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-trimethoxysilylbutyl 2-methylthiirane-2-carboxylate is sourced from PubChem (CID 175418228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).