C29H28F3N3O7 — CID 175418906
(2E)-2-methoxyimino-2-[3-[2-[(2E)-1-methoxy-2-methoxyiminoethoxy]-3-methylphenyl]-2-[[[3-(trifluoromethyl)phenyl]methylideneamino]methoxy]phenyl]acetic acid (PubChem CID 175418906) has the molecular formula C29H28F3N3O7 and a molecular weight of 587.55 g/mol. Its IUPAC name is (2E)-2-methoxyimino-2-[3-[2-[(2E)-1-methoxy-2-methoxyiminoethoxy]-3-methylphenyl]-2-[[[3-(trifluoromethyl)phenyl]methylideneamino]methoxy]phenyl]acetic acid.
| Compound Name | (2E)-2-methoxyimino-2-[3-[2-[(2E)-1-methoxy-2-methoxyiminoethoxy]-3-methylphenyl]-2-[[[3-(trifluoromethyl)phenyl]methylideneamino]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 175418906 |
| Molecular Formula | C29H28F3N3O7 |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | (2E)-2-methoxyimino-2-[3-[2-[(2E)-1-methoxy-2-methoxyiminoethoxy]-3-methylphenyl]-2-[[[3-(trifluoromethyl)phenyl]methylideneamino]methoxy]phenyl]acetic acid |
| SMILES | CO/N=C/C(OC)Oc1c(C)cccc1-c1cccc(/C(=N\OC)C(=O)O)c1OCN=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H28F3N3O7/c1-18-8-5-11-21(26(18)42-24(38-2)16-34-39-3)22-12-7-13-23(25(28(36)37)35-40-4)27(22)41-17-33-15-19-9-6-10-20(14-19)29(30,31)32/h5-16,24H,17H2,1-4H3,(H,36,37)/b33-15?,34-16+,35-25+ |
| InChIKey | AAIGOFNFDWHSCY-IMXDCZJASA-N |
| XLogP | 5.55 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|