C22H21Cl2FN2O5 — CID 175419155
(Z)-2-[5-chloro-4-[(2R)-2-[(3-chloro-2-pyridinyl)oxymethyl]pyrrolidin-1-yl]-2-fluorobenzoyl]-3-ethoxyprop-2-enoic acid (PubChem CID 175419155) has the molecular formula C22H21Cl2FN2O5 and a molecular weight of 483.32 g/mol. Its IUPAC name is (Z)-2-[5-chloro-4-[(2R)-2-[(3-chloro-2-pyridinyl)oxymethyl]pyrrolidin-1-yl]-2-fluorobenzoyl]-3-ethoxyprop-2-enoic acid.
| Compound Name | (Z)-2-[5-chloro-4-[(2R)-2-[(3-chloro-2-pyridinyl)oxymethyl]pyrrolidin-1-yl]-2-fluorobenzoyl]-3-ethoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 175419155 |
| Molecular Formula | C22H21Cl2FN2O5 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | (Z)-2-[5-chloro-4-[(2R)-2-[(3-chloro-2-pyridinyl)oxymethyl]pyrrolidin-1-yl]-2-fluorobenzoyl]-3-ethoxyprop-2-enoic acid |
| SMILES | CCO/C=C(\C(=O)O)C(=O)c1cc(Cl)c(N2CCC[C@@H]2COc2ncccc2Cl)cc1F |
| InChI | InChI=1S/C22H21Cl2FN2O5/c1-2-31-12-15(22(29)30)20(28)14-9-17(24)19(10-18(14)25)27-8-4-5-13(27)11-32-21-16(23)6-3-7-26-21/h3,6-7,9-10,12-13H,2,4-5,8,11H2,1H3,(H,29,30)/b15-12-/t13-/m1/s1 |
| InChIKey | MZCXNWCEQGCJLK-DKXRRRNBSA-N |
| XLogP | 4.76 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|