C22H24F2N2O4 — CID 156848185
ethyl 3-[2,5-difluoro-4-[(2R)-2-[(3-methyl-2-pyridinyl)oxymethyl]pyrrolidin-1-yl]phenyl]-3-oxopropanoate (PubChem CID 156848185) has the molecular formula C22H24F2N2O4 and a molecular weight of 418.44 g/mol. Its IUPAC name is ethyl 3-[2,5-difluoro-4-[(2R)-2-[(3-methyl-2-pyridinyl)oxymethyl]pyrrolidin-1-yl]phenyl]-3-oxopropanoate.
| Compound Name | ethyl 3-[2,5-difluoro-4-[(2R)-2-[(3-methyl-2-pyridinyl)oxymethyl]pyrrolidin-1-yl]phenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 156848185 |
| Molecular Formula | C22H24F2N2O4 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | ethyl 3-[2,5-difluoro-4-[(2R)-2-[(3-methyl-2-pyridinyl)oxymethyl]pyrrolidin-1-yl]phenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(F)c(N2CCC[C@@H]2COc2ncccc2C)cc1F |
| InChI | InChI=1S/C22H24F2N2O4/c1-3-29-21(28)12-20(27)16-10-18(24)19(11-17(16)23)26-9-5-7-15(26)13-30-22-14(2)6-4-8-25-22/h4,6,8,10-11,15H,3,5,7,9,12-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | UPZFURBZFMMAJU-OAHLLOKOSA-N |
| XLogP | 3.85 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|