C15H22N2O3 — CID 100698900
ethyl 2-[(2R)-1-[(2-methoxy-3-pyridinyl)methyl]pyrrolidin-2-yl]acetate (PubChem CID 100698900) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl 2-[(2R)-1-[(2-methoxy-3-pyridinyl)methyl]pyrrolidin-2-yl]acetate.
| Compound Name | ethyl 2-[(2R)-1-[(2-methoxy-3-pyridinyl)methyl]pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 100698900 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | ethyl 2-[(2R)-1-[(2-methoxy-3-pyridinyl)methyl]pyrrolidin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCCN1Cc1cccnc1OC |
| InChI | InChI=1S/C15H22N2O3/c1-3-20-14(18)10-13-7-5-9-17(13)11-12-6-4-8-16-15(12)19-2/h4,6,8,13H,3,5,7,9-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | BOGDHLJWJTWBIF-CYBMUJFWSA-N |
| XLogP | 2.01 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |