C20H23N5 — CID 175419322
bis(4,5-dihydro-1H-imidazole);2-phenyl-1H-indole (PubChem CID 175419322) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is bis(4,5-dihydro-1H-imidazole);2-phenyl-1H-indole.
| Compound Name | bis(4,5-dihydro-1H-imidazole);2-phenyl-1H-indole |
|---|---|
| PubChem CID | 175419322 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | bis(4,5-dihydro-1H-imidazole);2-phenyl-1H-indole |
| SMILES | C1=NCCN1.C1=NCCN1.c1ccc(-c2cc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C14H11N.2C3H6N2/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14;2*1-2-5-3-4-1/h1-10,15H;2*3H,1-2H2,(H,4,5) |
| InChIKey | JSTDGMPDQYKAMJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |