About bis(1H-imidazole);2-phenyl-1H-indole
bis(1H-imidazole);2-phenyl-1H-indole (PubChem CID 175361199) has the molecular formula C20H19N5
and a molecular weight of 329.41 g/mol. Its IUPAC name is bis(1H-imidazole);2-phenyl-1H-indole.
Molecular Properties
| Compound Name | bis(1H-imidazole);2-phenyl-1H-indole |
| PubChem CID | 175361199 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | bis(1H-imidazole);2-phenyl-1H-indole |
| SMILES | c1c[nH]cn1.c1c[nH]cn1.c1ccc(-c2cc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C14H11N.2C3H4N2/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14;2*1-2-5-3-4-1/h1-10,15H;2*1-3H,(H,4,5) |
| InChIKey | CNNNWJHTPACGOS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(1H-imidazole);2-phenyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-imidazole);2-phenyl-1H-indole?
The IUPAC name of bis(1H-imidazole);2-phenyl-1H-indole (CID 175361199) is bis(1H-imidazole);2-phenyl-1H-indole.
What is the SMILES notation for bis(1H-imidazole);2-phenyl-1H-indole?
The canonical SMILES for bis(1H-imidazole);2-phenyl-1H-indole is c1c[nH]cn1.c1c[nH]cn1.c1ccc(-c2cc3ccccc3[nH]2)cc1.
What is the InChIKey of bis(1H-imidazole);2-phenyl-1H-indole?
The InChIKey is CNNNWJHTPACGOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.2C3H4N2/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14;2*1-2-5-3-4-1/h1-10,15H;2*1-3H,(H,4,5).
What are the key properties of bis(1H-imidazole);2-phenyl-1H-indole?
bis(1H-imidazole);2-phenyl-1H-indole has a molecular weight of 329.41 g/mol, XLogP of 4.65, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-imidazole);2-phenyl-1H-indole is sourced from PubChem (CID 175361199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).