About (3-bromo-2,4-difluorophenyl) pentanoate
(3-bromo-2,4-difluorophenyl) pentanoate (PubChem CID 175420455) has the molecular formula C11H11BrF2O2
and a molecular weight of 293.11 g/mol. Its IUPAC name is (3-bromo-2,4-difluorophenyl) pentanoate.
Molecular Properties
| Compound Name | (3-bromo-2,4-difluorophenyl) pentanoate |
| PubChem CID | 175420455 |
| Molecular Formula | C11H11BrF2O2 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | (3-bromo-2,4-difluorophenyl) pentanoate |
| SMILES | CCCCC(=O)Oc1ccc(F)c(Br)c1F |
| InChI | InChI=1S/C11H11BrF2O2/c1-2-3-4-9(15)16-8-6-5-7(13)10(12)11(8)14/h5-6H,2-4H2,1H3 |
| InChIKey | BFDPRKNGWKSMRB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-2,4-difluorophenyl) pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-2,4-difluorophenyl) pentanoate?
The IUPAC name of (3-bromo-2,4-difluorophenyl) pentanoate (CID 175420455) is (3-bromo-2,4-difluorophenyl) pentanoate.
What is the SMILES notation for (3-bromo-2,4-difluorophenyl) pentanoate?
The canonical SMILES for (3-bromo-2,4-difluorophenyl) pentanoate is CCCCC(=O)Oc1ccc(F)c(Br)c1F.
What is the InChIKey of (3-bromo-2,4-difluorophenyl) pentanoate?
The InChIKey is BFDPRKNGWKSMRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF2O2/c1-2-3-4-9(15)16-8-6-5-7(13)10(12)11(8)14/h5-6H,2-4H2,1H3.
What are the key properties of (3-bromo-2,4-difluorophenyl) pentanoate?
(3-bromo-2,4-difluorophenyl) pentanoate has a molecular weight of 293.11 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-2,4-difluorophenyl) pentanoate is sourced from PubChem (CID 175420455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).