C21H30N4O — CID 175425942
1-[6-(2-methoxyphenyl)pyridazin-3-yl]-N-pentylpiperidin-3-amine (PubChem CID 175425942) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-[6-(2-methoxyphenyl)pyridazin-3-yl]-N-pentylpiperidin-3-amine.
| Compound Name | 1-[6-(2-methoxyphenyl)pyridazin-3-yl]-N-pentylpiperidin-3-amine |
|---|---|
| PubChem CID | 175425942 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-[6-(2-methoxyphenyl)pyridazin-3-yl]-N-pentylpiperidin-3-amine |
| SMILES | CCCCCNC1CCCN(c2ccc(-c3ccccc3OC)nn2)C1 |
| InChI | InChI=1S/C21H30N4O/c1-3-4-7-14-22-17-9-8-15-25(16-17)21-13-12-19(23-24-21)18-10-5-6-11-20(18)26-2/h5-6,10-13,17,22H,3-4,7-9,14-16H2,1-2H3 |
| InChIKey | NOVFHINRCRMOLJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|